Target Relevance

Molecular Definition

Canonical SMILES COc1ccc(C[C@@H](C)NC[C@@H](O)c2cc(O)cc(O)c2)cc1
Formula C18H23NO4
Molecular Weight 317.38 da
Stereocenters 2/2