Target Relevance

Molecular Definition

Canonical SMILES CCCCn1c(NCCCN2CCN(CC2)c3ccccc3)nc4N(C)C(=O)N(C)C(=O)c14
Formula C24H35N7O2
Molecular Weight 453.58 da
Stereocenters 0/0