Target Relevance

Molecular Definition

Canonical SMILES CCC(=O)NCCc1nc(c2nc(C)cs2)c([nH]1)c3ccc4ncsc4c3
Formula C19H19N5OS2
Molecular Weight 397.52 da
Stereocenters 0/0