Target Relevance

Molecular Definition

Canonical SMILES CCCC(=O)N(C)Cc1nc(c2nc(C)cs2)c([nH]1)c3ccc4ncsc4c3
Formula C20H21N5OS2
Molecular Weight 411.54 da
Stereocenters 0/0