Target Relevance

Molecular Definition

Canonical SMILES Cc1csc(n1)c2nc(CN3CCCC3=O)[nH]c2c4ccc5ncsc5c4
Formula C19H17N5OS2
Molecular Weight 395.50 da
Stereocenters 0/0