Target Relevance

Molecular Definition

Canonical SMILES C[C@@H]1CC[C@H](CC1)[C@](C)(NC(=O)c2ccsc2)c3cn(CC#N)nn3
Formula C18H23N5OS
Molecular Weight 357.47 da
Stereocenters 3/3