Molecular Definition

Canonical SMILES COCCN(C)S(=O)(=O)Nc1cc(Nc2ncc(Cl)cc2c3nc(C)nc(N)n3)cnc1Cl
Formula C18H21Cl2N9O3S
Molecular Weight 514.39 da
Stereocenters 0/0