Molecular Definition

Canonical SMILES COc1ccc(cc1S(=O)(=O)NC2CCCC2)c3c(C)onc3C
Formula C17H22N2O4S
Molecular Weight 350.43 da
Stereocenters 0/0