Target Relevance

Molecular Definition

Canonical SMILES CC(C)[C@@H](NC(=O)CCCc1ccccc1)C(=O)N2CCC(CC2)c3ccc(Cl)cc3
Formula C26H33ClN2O2
Molecular Weight 441.01 da
Stereocenters 1/1