Target Relevance

Molecular Definition

Canonical SMILES CC(C)C(NC(=O)c1ccc2ccccc2c1)C(=O)N3CCC(CC3)c4ccc(Cl)cc4
Formula C27H29ClN2O2
Molecular Weight 448.98 da
Stereocenters 0/1