Molecular Definition

Canonical SMILES C[C@H](N1CC(C1)Oc2ccccc2)C3=Nc4c(cnn4C5CCCC5)C(=O)N3
Formula C21H25N5O2
Molecular Weight 379.46 da
Stereocenters 1/1