Molecular Definition

Canonical SMILES CN(C)S(=O)(=O)CCCn1c2CCCCc2c3cc(ccc13)C#N
Formula C18H23N3O2S
Molecular Weight 345.46 da
Stereocenters 0/0