Molecular Definition

Canonical SMILES CS(=O)(=O)c1ccc2c(c1)c3CCCCc3n2CCCc4nc5ccccc5[nH]4
Formula C23H25N3O2S
Molecular Weight 407.53 da
Stereocenters 0/0