Molecular Definition

Canonical SMILES CN(C)S(=O)(=O)CCCn1c2CCCCc2c3cc(ccc13)S(=O)(=O)C
Formula C18H26N2O4S2
Molecular Weight 398.54 da
Stereocenters 0/0