Target Relevance

Molecular Definition

Canonical SMILES Cc1ccc2Nc3nc(ccc3CN(c2c1C)S(=O)(=O)c4ccc(cc4)S(=O)(=O)C)C(F)(F)F
Formula C22H20F3N3O4S2
Molecular Weight 511.54 da
Stereocenters 0/0