Molecular Definition

Canonical SMILES COc1ccc2c(SCc3cnn(c4ccc(cc4)S(=O)(=O)N)c23)c1
Formula C17H15N3O3S2
Molecular Weight 373.45 da
Stereocenters 0/0