Molecular Definition

Canonical SMILES Cc1ccc2c(SCc3cnn(c4ccc(cc4)S(=O)(=O)N)c23)n1
Formula C16H14N4O2S2
Molecular Weight 358.44 da
Stereocenters 0/0