Target Relevance

Molecular Definition

Canonical SMILES Cn1c(cc(c2ccc(O)cc2)c1c3ccc(O)cc3)c4ccc(O)cc4Cl
Formula C23H18ClNO3
Molecular Weight 391.85 da
Stereocenters 0/0