Molecular Definition

Canonical SMILES C[C@@H]1CNC[C@H]1C2=Nc3c(cnn3C4CCOCC4)C(=O)N2
Formula C15H21N5O2
Molecular Weight 303.36 da
Stereocenters 2/2