Molecular Definition

Canonical SMILES C[C@H]1CN(Cc2ccccc2)C[C@@H]1C3=Nc4c(cnn4C5CCOCC5)C(=O)N3
Formula C22H27N5O2
Molecular Weight 393.48 da
Stereocenters 2/2