Molecular Definition

Canonical SMILES C[C@@H](N1CCC1)C2=Nc3c(cnn3C4CCCC4)C(=O)N2
Formula C15H21N5O
Molecular Weight 287.36 da
Stereocenters 1/1