Target Relevance

Molecular Definition

Canonical SMILES NC(=N)NC(=O)c1ccc(C2CCN(CC2)C(=O)c3cccc(Cl)c3)c(c1)C(F)(F)F
Formula C21H20ClF3N4O2
Molecular Weight 452.86 da
Stereocenters 0/0