Target Relevance

Molecular Definition

Canonical SMILES NC(=N)NC(=O)c1ccc(C2CCN(CC2)C(=O)c3ccc(cc3)C(F)(F)F)c(c1)C(F)(F)F
Formula C22H20F6N4O2
Molecular Weight 486.41 da
Stereocenters 0/0