Target Relevance

Molecular Definition

Canonical SMILES Cc1ccc2Nc3nc(ccc3CN(c2c1C)S(=O)(=O)c4ccc(cc4)C(C)(C)C)C(F)(F)F
Formula C25H26F3N3O2S
Molecular Weight 489.55 da
Stereocenters 0/0