Target Relevance

Molecular Definition

Canonical SMILES Cl.CCCCCCCCCN(CCCCCCCCC)[C@@H]1[C@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H]1O
Formula C24H50ClNO5
Molecular Weight 468.11 da
Stereocenters 6/6