Molecular Definition

Canonical SMILES COc1ccccc1C(=O)c2cnc(NC3CCN(CC3)S(=O)(=O)C)nc2N
Formula C18H23N5O4S
Molecular Weight 405.47 da
Stereocenters 0/0