Target Relevance

Molecular Definition

Canonical SMILES Cl.COc1cccc(OC)c1OCCNC[C@@H]2COc3cc4CCCCc4cc3O2
Formula C23H30ClNO5
Molecular Weight 435.94 da
Stereocenters 1/1