Target Relevance

Molecular Definition

Canonical SMILES CC(C)[C@H](N\C(=N/S(=O)(=O)c1ccc(Cl)cc1)\N2CC(C(=N2)c3ccc(Cl)cc3)c4ccccc4)C(=O)N[C@@H](C)C(=O)N
Formula C30H32Cl2N6O4S
Molecular Weight 643.58 da
Stereocenters 2/3