Target Relevance

Molecular Definition

Canonical SMILES Cc1ccc(cc1)c2cncnc2N3CCC(CC3)c4[nH]cnc4C
Formula C20H23N5
Molecular Weight 333.43 da
Stereocenters 0/0