Molecular Definition

Canonical SMILES [O-][N+](=O)c1ccc(CCCN2CCN(CCc3ccc(cc3)[N+](=O)[O-])CC2)cc1
Formula C21H26N4O4
Molecular Weight 398.46 da
Stereocenters 0/0