Molecular Definition

Canonical SMILES CS(=O)(=O)c1ccc(CCN2CCN(CCc3ccc(cc3)[N+](=O)[O-])CC2)cc1
Formula C21H27N3O4S
Molecular Weight 417.52 da
Stereocenters 0/0