Molecular Definition

Canonical SMILES COc1ccc(CCN2CCN(CCc3ccc(cc3)[N+](=O)[O-])CC2)cc1
Formula C21H27N3O3
Molecular Weight 369.46 da
Stereocenters 0/0