Molecular Definition

Canonical SMILES [O-][N+](=O)c1ccc(CCN2CCN(CCc3ccc(F)cc3)CC2)cc1
Formula C20H24FN3O2
Molecular Weight 357.42 da
Stereocenters 0/0