Molecular Definition

Canonical SMILES CCOC(=O)c1ccc(CCN2CCN(CCc3ccc(cc3)[N+](=O)[O-])CC2)cc1
Formula C23H29N3O4
Molecular Weight 411.49 da
Stereocenters 0/0