Molecular Definition

Canonical SMILES [O-][N+](=O)c1ccc(CCN2CCN(CCc3ccc(cc3)c4occn4)CC2)cc1
Formula C23H26N4O3
Molecular Weight 406.48 da
Stereocenters 0/0