Molecular Definition

Canonical SMILES [O-][N+](=O)c1ccc(CCN2CCN(CCc3cccc(c3)C#N)CC2)cc1
Formula C21H24N4O2
Molecular Weight 364.44 da
Stereocenters 0/0