Molecular Definition

Canonical SMILES [O-][N+](=O)c1ccc(CCN2CCNCC2)cc1
Formula C12H17N3O2
Molecular Weight 235.28 da
Stereocenters 0/0