Target Relevance

Molecular Definition

Canonical SMILES COc1ccc(cc1OCCN2CCCCC2)N3CCC(C3=O)c4cccc(F)c4
Formula C24H29FN2O3
Molecular Weight 412.50 da
Stereocenters 0/1