Target Relevance

Molecular Definition

Canonical SMILES COc1ccccc1c2cncnc2N3CCC(CC3)c4[nH]cnc4C
Formula C20H23N5O
Molecular Weight 349.43 da
Stereocenters 0/0