Target Relevance

Molecular Definition

Canonical SMILES CC(C)[C@@H](NCC(=O)O)C(=O)N[C@@H](Cc1ccccc1)C(=O)NCc2ccc(cc2)C(=N)N
Formula C24H31N5O4
Molecular Weight 453.53 da
Stereocenters 2/2