Molecular Definition

Canonical SMILES CCC(=C)C(=O)c1ccc(OCC(=O)NCc2cc(CNC(=O)COc3ccc(C(=O)C(=C)CC)c(Cl)c3Cl)cc(c2)C(=O)N)c(Cl)c1Cl
Formula C35H33Cl4N3O7
Molecular Weight 749.46 da
Stereocenters 0/0