Target Relevance

Molecular Definition

Canonical SMILES CCC(=C)C(=O)c1ccc(OCC(=O)NCCC(=O)NCc2cc(CNC(=O)CCNC(=O)COc3ccc(C(=O)C(=C)C)c(Cl)c3Cl)cc(c2)C(=O)N)c(Cl)c1Cl
Formula C40H41Cl4N5O9
Molecular Weight 877.59 da
Stereocenters 0/0