Molecular Definition

Canonical SMILES C1CCN(CC1)C2CCN(CC2)c3ccc4[nH]c(nc4c3)c5[nH]nc6ccc(Oc7ccccc7)cc56
Formula C30H32N6O
Molecular Weight 492.61 da
Stereocenters 0/0