Molecular Definition

Canonical SMILES CC1=C(C(NC(=O)N1)c2ccc(cc2)C(F)(F)F)C(=O)OC3CCCC3
Formula C18H19F3N2O3
Molecular Weight 368.35 da
Stereocenters 0/1