Molecular Definition

Canonical SMILES CC[C@@H]1CC[C@H](CC1)OC(=O)C2=C(C)NC(=O)NC2c3ccc(cc3)[N+](=O)[O-]
Formula C20H25N3O5
Molecular Weight 387.43 da
Stereocenters 2/3