Molecular Definition

Canonical SMILES CCO[C@H](Cc1ccc(OC\C=C\C#Cc2ccc(cc2)C#C\C=C\COc3ccc(C[C@@H](OCC)C(=O)O)cc3)cc1)C(=O)O
Formula C38H38O8
Molecular Weight 622.70 da
Stereocenters 2/2