Target Relevance

Molecular Definition

Canonical SMILES CCc1c(Cc2ccccc2c3ccccc3)n4ccc(OCCC(=O)O)cc4c1C(=O)C(=O)N
Formula C28H26N2O5
Molecular Weight 470.52 da
Stereocenters 0/0