Molecular Definition

Canonical SMILES COc1ccc(C)cc1NC(=O)N(CCc2ccc(SC(C)(C)C(=O)O)cc2)CCc3ccc(cc3)c4ccccc4
Formula C35H38N2O4S
Molecular Weight 582.75 da
Stereocenters 0/0