Target Relevance

Molecular Definition

Canonical SMILES CCC1C2CC3C4N(C)c5ccccc5C46CC(C2[C@H]6O)N3C1O
Formula C20H26N2O2
Molecular Weight 326.43 da
Stereocenters 1/9