Molecular Definition

Canonical SMILES Clc1cc(ccc1OC[C@H]2CC[C@H](N2)C(=O)N3CCC[C@H]3C#N)C#N
Formula C18H19ClN4O2
Molecular Weight 358.82 da
Stereocenters 3/3